C21H25Cl — CID 118912523
1-chloro-4-[4-(4-propylcyclohexyl)phenyl]benzene (PubChem CID 118912523) has the molecular formula C21H25Cl and a molecular weight of 312.88 g/mol. Its IUPAC name is 1-chloro-4-[4-(4-propylcyclohexyl)phenyl]benzene.
| Compound Name | 1-chloro-4-[4-(4-propylcyclohexyl)phenyl]benzene |
|---|---|
| PubChem CID | 118912523 |
| Molecular Formula | C21H25Cl |
| Molecular Weight | 312.88 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 1-chloro-4-[4-(4-propylcyclohexyl)phenyl]benzene |
| SMILES | CCCC1CCC(c2ccc(-c3ccc(Cl)cc3)cc2)CC1 |
| InChI | InChI=1S/C21H25Cl/c1-2-3-16-4-6-17(7-5-16)18-8-10-19(11-9-18)20-12-14-21(22)15-13-20/h8-17H,2-7H2,1H3 |
| InChIKey | LZYSEYYGDKAHSJ-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.88 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |