C22H25Cl — CID 67569865
1-[4-[(E)-but-2-enyl]cyclohexyl]-4-(4-chlorophenyl)benzene (PubChem CID 67569865) has the molecular formula C22H25Cl and a molecular weight of 324.90 g/mol. Its IUPAC name is 1-[4-[(E)-but-2-enyl]cyclohexyl]-4-(4-chlorophenyl)benzene.
| Compound Name | 1-[4-[(E)-but-2-enyl]cyclohexyl]-4-(4-chlorophenyl)benzene |
|---|---|
| PubChem CID | 67569865 |
| Molecular Formula | C22H25Cl |
| Molecular Weight | 324.90 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 1-[4-[(E)-but-2-enyl]cyclohexyl]-4-(4-chlorophenyl)benzene |
| SMILES | C/C=C/CC1CCC(c2ccc(-c3ccc(Cl)cc3)cc2)CC1 |
| InChI | InChI=1S/C22H25Cl/c1-2-3-4-17-5-7-18(8-6-17)19-9-11-20(12-10-19)21-13-15-22(23)16-14-21/h2-3,9-18H,4-8H2,1H3/b3-2+ |
| InChIKey | LEMMMVHXZOLUCQ-NSCUHMNNSA-N |
| XLogP | 7.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.90 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|