C24H30 — CID 18341909
1-methyl-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]benzene (PubChem CID 18341909) has the molecular formula C24H30 and a molecular weight of 318.50 g/mol. Its IUPAC name is 1-methyl-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]benzene.
| Compound Name | 1-methyl-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]benzene |
|---|---|
| PubChem CID | 18341909 |
| Molecular Formula | C24H30 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 1-methyl-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]benzene |
| SMILES | C/C=C/CCC1CCC(c2ccc(-c3ccc(C)cc3)cc2)CC1 |
| InChI | InChI=1S/C24H30/c1-3-4-5-6-20-9-13-22(14-10-20)24-17-15-23(16-18-24)21-11-7-19(2)8-12-21/h3-4,7-8,11-12,15-18,20,22H,5-6,9-10,13-14H2,1-2H3/b4-3+ |
| InChIKey | OSEGRSWKSZYORA-ONEGZZNKSA-N |
| XLogP | 7.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|