C23H34 — CID 18724321
1-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-4-methylbenzene (PubChem CID 18724321) has the molecular formula C23H34 and a molecular weight of 310.53 g/mol. Its IUPAC name is 1-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-4-methylbenzene.
| Compound Name | 1-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-4-methylbenzene |
|---|---|
| PubChem CID | 18724321 |
| Molecular Formula | C23H34 |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.27 |
| IUPAC Name | 1-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-4-methylbenzene |
| SMILES | C=CCCC1CCC(C2CCC(c3ccc(C)cc3)CC2)CC1 |
| InChI | InChI=1S/C23H34/c1-3-4-5-19-8-12-21(13-9-19)23-16-14-22(15-17-23)20-10-6-18(2)7-11-20/h3,6-7,10-11,19,21-23H,1,4-5,8-9,12-17H2,2H3 |
| InChIKey | OXPUOKDPOMJNKA-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|