C30H39FO — CID 138459502
4-[4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]phenyl]-1-ethoxy-2-fluorobenzene (PubChem CID 138459502) has the molecular formula C30H39FO and a molecular weight of 434.64 g/mol. Its IUPAC name is 4-[4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]phenyl]-1-ethoxy-2-fluorobenzene.
| Compound Name | 4-[4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]phenyl]-1-ethoxy-2-fluorobenzene |
|---|---|
| PubChem CID | 138459502 |
| Molecular Formula | C30H39FO |
| Molecular Weight | 434.64 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | 4-[4-[4-(4-but-3-enylcyclohexyl)cyclohexyl]phenyl]-1-ethoxy-2-fluorobenzene |
| SMILES | C=CCCC1CCC(C2CCC(c3ccc(-c4ccc(OCC)c(F)c4)cc3)CC2)CC1 |
| InChI | InChI=1S/C30H39FO/c1-3-5-6-22-7-9-23(10-8-22)24-11-13-25(14-12-24)26-15-17-27(18-16-26)28-19-20-30(32-4-2)29(31)21-28/h3,15-25H,1,4-14H2,2H3 |
| InChIKey | LZBXGBFTDCXBJC-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.64 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|