C23H27FO2 — CID 138459505
1-ethoxy-2-fluoro-4-[4-(4-prop-2-enoxycyclohexyl)phenyl]benzene (PubChem CID 138459505) has the molecular formula C23H27FO2 and a molecular weight of 354.47 g/mol. Its IUPAC name is 1-ethoxy-2-fluoro-4-[4-(4-prop-2-enoxycyclohexyl)phenyl]benzene.
| Compound Name | 1-ethoxy-2-fluoro-4-[4-(4-prop-2-enoxycyclohexyl)phenyl]benzene |
|---|---|
| PubChem CID | 138459505 |
| Molecular Formula | C23H27FO2 |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 1-ethoxy-2-fluoro-4-[4-(4-prop-2-enoxycyclohexyl)phenyl]benzene |
| SMILES | C=CCOC1CCC(c2ccc(-c3ccc(OCC)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C23H27FO2/c1-3-15-26-21-12-9-18(10-13-21)17-5-7-19(8-6-17)20-11-14-23(25-4-2)22(24)16-20/h3,5-8,11,14,16,18,21H,1,4,9-10,12-13,15H2,2H3 |
| InChIKey | DJPILQYGALIKOY-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|