C32H45FOSi — CID 54732129
4-[2-[4-[4-(4-ethoxy-3-fluorophenyl)phenyl]cyclohexyl]ethyl]-1-pent-4-enylsilinane (PubChem CID 54732129) has the molecular formula C32H45FOSi and a molecular weight of 492.80 g/mol. Its IUPAC name is 4-[2-[4-[4-(4-ethoxy-3-fluorophenyl)phenyl]cyclohexyl]ethyl]-1-pent-4-enylsilinane.
| Compound Name | 4-[2-[4-[4-(4-ethoxy-3-fluorophenyl)phenyl]cyclohexyl]ethyl]-1-pent-4-enylsilinane |
|---|---|
| PubChem CID | 54732129 |
| Molecular Formula | C32H45FOSi |
| Molecular Weight | 492.80 g/mol |
| Exact Mass | 492.32 |
| IUPAC Name | 4-[2-[4-[4-(4-ethoxy-3-fluorophenyl)phenyl]cyclohexyl]ethyl]-1-pent-4-enylsilinane |
| SMILES | C=CCCC[SiH]1CCC(CCC2CCC(c3ccc(-c4ccc(OCC)c(F)c4)cc3)CC2)CC1 |
| InChI | InChI=1S/C32H45FOSi/c1-3-5-6-21-35-22-19-26(20-23-35)8-7-25-9-11-27(12-10-25)28-13-15-29(16-14-28)30-17-18-32(34-4-2)31(33)24-30/h3,13-18,24-27,35H,1,4-12,19-23H2,2H3 |
| InChIKey | KHVKFKCDHRTNFZ-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.80 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|