C25H25FO2 — CID 69031311
1-ethoxy-2-fluoro-4-[4-(4-pent-4-enoxyphenyl)phenyl]benzene (PubChem CID 69031311) has the molecular formula C25H25FO2 and a molecular weight of 376.47 g/mol. Its IUPAC name is 1-ethoxy-2-fluoro-4-[4-(4-pent-4-enoxyphenyl)phenyl]benzene.
| Compound Name | 1-ethoxy-2-fluoro-4-[4-(4-pent-4-enoxyphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 69031311 |
| Molecular Formula | C25H25FO2 |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 1-ethoxy-2-fluoro-4-[4-(4-pent-4-enoxyphenyl)phenyl]benzene |
| SMILES | C=CCCCOc1ccc(-c2ccc(-c3ccc(OCC)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C25H25FO2/c1-3-5-6-17-28-23-14-11-20(12-15-23)19-7-9-21(10-8-19)22-13-16-25(27-4-2)24(26)18-22/h3,7-16,18H,1,4-6,17H2,2H3 |
| InChIKey | UXTDKTJMBQEOKY-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|