C34H31F3O4 — CID 89430936
[4-[4-(4-butoxyphenyl)-2,3-difluorophenyl]phenyl] 3-fluoro-4-pent-4-enoxybenzoate (PubChem CID 89430936) has the molecular formula C34H31F3O4 and a molecular weight of 560.61 g/mol. Its IUPAC name is [4-[4-(4-butoxyphenyl)-2,3-difluorophenyl]phenyl] 3-fluoro-4-pent-4-enoxybenzoate.
| Compound Name | [4-[4-(4-butoxyphenyl)-2,3-difluorophenyl]phenyl] 3-fluoro-4-pent-4-enoxybenzoate |
|---|---|
| PubChem CID | 89430936 |
| Molecular Formula | C34H31F3O4 |
| Molecular Weight | 560.61 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | [4-[4-(4-butoxyphenyl)-2,3-difluorophenyl]phenyl] 3-fluoro-4-pent-4-enoxybenzoate |
| SMILES | C=CCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(-c4ccc(OCCCC)cc4)c(F)c3F)cc2)cc1F |
| InChI | InChI=1S/C34H31F3O4/c1-3-5-7-21-40-31-19-12-25(22-30(31)35)34(38)41-27-15-10-24(11-16-27)29-18-17-28(32(36)33(29)37)23-8-13-26(14-9-23)39-20-6-4-2/h3,8-19,22H,1,4-7,20-21H2,2H3 |
| InChIKey | MQBMTYORXPYYHI-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.61 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|