C31H31F3O4 — CID 89431105
(4-but-3-enoxy-3-fluorophenyl) 4-[4-(4-ethoxycyclohexyl)-2,3-difluorophenyl]benzoate (PubChem CID 89431105) has the molecular formula C31H31F3O4 and a molecular weight of 524.58 g/mol. Its IUPAC name is (4-but-3-enoxy-3-fluorophenyl) 4-[4-(4-ethoxycyclohexyl)-2,3-difluorophenyl]benzoate.
| Compound Name | (4-but-3-enoxy-3-fluorophenyl) 4-[4-(4-ethoxycyclohexyl)-2,3-difluorophenyl]benzoate |
|---|---|
| PubChem CID | 89431105 |
| Molecular Formula | C31H31F3O4 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | (4-but-3-enoxy-3-fluorophenyl) 4-[4-(4-ethoxycyclohexyl)-2,3-difluorophenyl]benzoate |
| SMILES | C=CCCOc1ccc(OC(=O)c2ccc(-c3ccc(C4CCC(OCC)CC4)c(F)c3F)cc2)cc1F |
| InChI | InChI=1S/C31H31F3O4/c1-3-5-18-37-28-17-14-24(19-27(28)32)38-31(35)22-8-6-20(7-9-22)25-15-16-26(30(34)29(25)33)21-10-12-23(13-11-21)36-4-2/h3,6-9,14-17,19,21,23H,1,4-5,10-13,18H2,2H3 |
| InChIKey | ZRMPLSFAAPLTOL-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|