C33H36F4O3 — CID 89430912
1-but-3-enoxy-4-[[4-[4-(4-butoxyphenyl)-2,3-difluorophenyl]cyclohexyl]oxymethyl]-2,3-difluorobenzene (PubChem CID 89430912) has the molecular formula C33H36F4O3 and a molecular weight of 556.64 g/mol. Its IUPAC name is 1-but-3-enoxy-4-[[4-[4-(4-butoxyphenyl)-2,3-difluorophenyl]cyclohexyl]oxymethyl]-2,3-difluorobenzene.
| Compound Name | 1-but-3-enoxy-4-[[4-[4-(4-butoxyphenyl)-2,3-difluorophenyl]cyclohexyl]oxymethyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 89430912 |
| Molecular Formula | C33H36F4O3 |
| Molecular Weight | 556.64 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | 1-but-3-enoxy-4-[[4-[4-(4-butoxyphenyl)-2,3-difluorophenyl]cyclohexyl]oxymethyl]-2,3-difluorobenzene |
| SMILES | C=CCCOc1ccc(COC2CCC(c3ccc(-c4ccc(OCCCC)cc4)c(F)c3F)CC2)c(F)c1F |
| InChI | InChI=1S/C33H36F4O3/c1-3-5-19-38-25-12-7-22(8-13-25)27-16-17-28(32(36)31(27)35)23-9-14-26(15-10-23)40-21-24-11-18-29(33(37)30(24)34)39-20-6-4-2/h4,7-8,11-13,16-18,23,26H,2-3,5-6,9-10,14-15,19-21H2,1H3 |
| InChIKey | PORLQFKIKWTDRN-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.64 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|