C31H32F4O3 — CID 89430565
1-but-3-enoxy-4-[[4-[4-(4-ethoxycyclohexyl)-2,3-difluorophenyl]phenyl]methoxy]-2,3-difluorobenzene (PubChem CID 89430565) has the molecular formula C31H32F4O3 and a molecular weight of 528.59 g/mol. Its IUPAC name is 1-but-3-enoxy-4-[[4-[4-(4-ethoxycyclohexyl)-2,3-difluorophenyl]phenyl]methoxy]-2,3-difluorobenzene.
| Compound Name | 1-but-3-enoxy-4-[[4-[4-(4-ethoxycyclohexyl)-2,3-difluorophenyl]phenyl]methoxy]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 89430565 |
| Molecular Formula | C31H32F4O3 |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | 1-but-3-enoxy-4-[[4-[4-(4-ethoxycyclohexyl)-2,3-difluorophenyl]phenyl]methoxy]-2,3-difluorobenzene |
| SMILES | C=CCCOc1ccc(OCc2ccc(-c3ccc(C4CCC(OCC)CC4)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C31H32F4O3/c1-3-5-18-37-26-16-17-27(31(35)30(26)34)38-19-20-6-8-21(9-7-20)24-14-15-25(29(33)28(24)32)22-10-12-23(13-11-22)36-4-2/h3,6-9,14-17,22-23H,1,4-5,10-13,18-19H2,2H3 |
| InChIKey | WQKKIPKMKUELBE-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|