C30H31F3O3 — CID 89430512
1-(4-ethoxycyclohexyl)-2,3-difluoro-4-[4-[(3-fluoro-4-prop-2-enoxyphenyl)methoxy]phenyl]benzene (PubChem CID 89430512) has the molecular formula C30H31F3O3 and a molecular weight of 496.57 g/mol. Its IUPAC name is 1-(4-ethoxycyclohexyl)-2,3-difluoro-4-[4-[(3-fluoro-4-prop-2-enoxyphenyl)methoxy]phenyl]benzene.
| Compound Name | 1-(4-ethoxycyclohexyl)-2,3-difluoro-4-[4-[(3-fluoro-4-prop-2-enoxyphenyl)methoxy]phenyl]benzene |
|---|---|
| PubChem CID | 89430512 |
| Molecular Formula | C30H31F3O3 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | 1-(4-ethoxycyclohexyl)-2,3-difluoro-4-[4-[(3-fluoro-4-prop-2-enoxyphenyl)methoxy]phenyl]benzene |
| SMILES | C=CCOc1ccc(COc2ccc(-c3ccc(C4CCC(OCC)CC4)c(F)c3F)cc2)cc1F |
| InChI | InChI=1S/C30H31F3O3/c1-3-17-35-28-16-5-20(18-27(28)31)19-36-24-12-8-22(9-13-24)26-15-14-25(29(32)30(26)33)21-6-10-23(11-7-21)34-4-2/h3,5,8-9,12-16,18,21,23H,1,4,6-7,10-11,17,19H2,2H3 |
| InChIKey | ZMQFLQVRMBVITF-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|