C30H31F3O2 — CID 89430318
1-(4-ethoxycyclohexyl)-4-[4-[(E)-2-(4-ethoxy-3-fluorophenyl)ethenyl]phenyl]-2,3-difluorobenzene (PubChem CID 89430318) has the molecular formula C30H31F3O2 and a molecular weight of 480.57 g/mol. Its IUPAC name is 1-(4-ethoxycyclohexyl)-4-[4-[(E)-2-(4-ethoxy-3-fluorophenyl)ethenyl]phenyl]-2,3-difluorobenzene.
| Compound Name | 1-(4-ethoxycyclohexyl)-4-[4-[(E)-2-(4-ethoxy-3-fluorophenyl)ethenyl]phenyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 89430318 |
| Molecular Formula | C30H31F3O2 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 1-(4-ethoxycyclohexyl)-4-[4-[(E)-2-(4-ethoxy-3-fluorophenyl)ethenyl]phenyl]-2,3-difluorobenzene |
| SMILES | CCOc1ccc(/C=C/c2ccc(-c3ccc(C4CCC(OCC)CC4)c(F)c3F)cc2)cc1F |
| InChI | InChI=1S/C30H31F3O2/c1-3-34-24-14-12-23(13-15-24)26-17-16-25(29(32)30(26)33)22-10-7-20(8-11-22)5-6-21-9-18-28(35-4-2)27(31)19-21/h5-11,16-19,23-24H,3-4,12-15H2,1-2H3/b6-5+ |
| InChIKey | WBLUAGQOZYBWTQ-AATRIKPKSA-N |
| XLogP | 8.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|