C30H25F3O — CID 77470948
1-[4-[2-(4-ethoxy-3-fluorophenyl)ethenyl]phenyl]-4-(4-ethylphenyl)-2,3-difluorobenzene (PubChem CID 77470948) has the molecular formula C30H25F3O and a molecular weight of 458.52 g/mol. Its IUPAC name is 1-[4-[2-(4-ethoxy-3-fluorophenyl)ethenyl]phenyl]-4-(4-ethylphenyl)-2,3-difluorobenzene.
| Compound Name | 1-[4-[2-(4-ethoxy-3-fluorophenyl)ethenyl]phenyl]-4-(4-ethylphenyl)-2,3-difluorobenzene |
|---|---|
| PubChem CID | 77470948 |
| Molecular Formula | C30H25F3O |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 1-[4-[2-(4-ethoxy-3-fluorophenyl)ethenyl]phenyl]-4-(4-ethylphenyl)-2,3-difluorobenzene |
| SMILES | CCOc1ccc(C=Cc2ccc(-c3ccc(-c4ccc(CC)cc4)c(F)c3F)cc2)cc1F |
| InChI | InChI=1S/C30H25F3O/c1-3-20-7-12-23(13-8-20)25-16-17-26(30(33)29(25)32)24-14-9-21(10-15-24)5-6-22-11-18-28(34-4-2)27(31)19-22/h5-19H,3-4H2,1-2H3 |
| InChIKey | RWAJLJZCPMUODH-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|