C25H22F4O — CID 58698147
1-ethoxy-2-fluoro-4-[2-[4-[(2S)-3,3,3-trifluoro-2-phenylpropyl]phenyl]ethenyl]benzene (PubChem CID 58698147) has the molecular formula C25H22F4O and a molecular weight of 414.44 g/mol. Its IUPAC name is 1-ethoxy-2-fluoro-4-[2-[4-[(2S)-3,3,3-trifluoro-2-phenylpropyl]phenyl]ethenyl]benzene.
| Compound Name | 1-ethoxy-2-fluoro-4-[2-[4-[(2S)-3,3,3-trifluoro-2-phenylpropyl]phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 58698147 |
| Molecular Formula | C25H22F4O |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 1-ethoxy-2-fluoro-4-[2-[4-[(2S)-3,3,3-trifluoro-2-phenylpropyl]phenyl]ethenyl]benzene |
| SMILES | CCOc1ccc(C=Cc2ccc(C[C@@H](c3ccccc3)C(F)(F)F)cc2)cc1F |
| InChI | InChI=1S/C25H22F4O/c1-2-30-24-15-14-20(17-23(24)26)13-10-18-8-11-19(12-9-18)16-22(25(27,28)29)21-6-4-3-5-7-21/h3-15,17,22H,2,16H2,1H3/t22-/m0/s1 |
| InChIKey | WRPCHKHKRNQKRD-QFIPXVFZSA-N |
| XLogP | 7.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|