C25H24F2O — CID 58698774
2-ethoxy-1,3-difluoro-5-[2-[4-[(2R)-2-phenylpropyl]phenyl]ethenyl]benzene (PubChem CID 58698774) has the molecular formula C25H24F2O and a molecular weight of 378.46 g/mol. Its IUPAC name is 2-ethoxy-1,3-difluoro-5-[2-[4-[(2R)-2-phenylpropyl]phenyl]ethenyl]benzene.
| Compound Name | 2-ethoxy-1,3-difluoro-5-[2-[4-[(2R)-2-phenylpropyl]phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 58698774 |
| Molecular Formula | C25H24F2O |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 2-ethoxy-1,3-difluoro-5-[2-[4-[(2R)-2-phenylpropyl]phenyl]ethenyl]benzene |
| SMILES | CCOc1c(F)cc(C=Cc2ccc(C[C@@H](C)c3ccccc3)cc2)cc1F |
| InChI | InChI=1S/C25H24F2O/c1-3-28-25-23(26)16-21(17-24(25)27)14-11-19-9-12-20(13-10-19)15-18(2)22-7-5-4-6-8-22/h4-14,16-18H,3,15H2,1-2H3/t18-/m1/s1 |
| InChIKey | MUEVVPOLMGYHIF-GOSISDBHSA-N |
| XLogP | 6.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|