C33H34O — CID 58699069
1-ethoxy-4-[2-[4-[2-[4-[(2S)-2-phenylpropyl]phenyl]ethyl]phenyl]ethenyl]benzene (PubChem CID 58699069) has the molecular formula C33H34O and a molecular weight of 446.63 g/mol. Its IUPAC name is 1-ethoxy-4-[2-[4-[2-[4-[(2S)-2-phenylpropyl]phenyl]ethyl]phenyl]ethenyl]benzene.
| Compound Name | 1-ethoxy-4-[2-[4-[2-[4-[(2S)-2-phenylpropyl]phenyl]ethyl]phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 58699069 |
| Molecular Formula | C33H34O |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | 1-ethoxy-4-[2-[4-[2-[4-[(2S)-2-phenylpropyl]phenyl]ethyl]phenyl]ethenyl]benzene |
| SMILES | CCOc1ccc(C=Cc2ccc(CCc3ccc(C[C@H](C)c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H34O/c1-3-34-33-23-21-30(22-24-33)16-15-28-11-9-27(10-12-28)13-14-29-17-19-31(20-18-29)25-26(2)32-7-5-4-6-8-32/h4-12,15-24,26H,3,13-14,25H2,1-2H3/t26-/m0/s1 |
| InChIKey | MIUMLPLBUAQNPC-SANMLTNESA-N |
| XLogP | 8.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|