C31H38O — CID 58699027
1-ethoxy-4-[2-[4-[4-[(2R)-2-phenylpropyl]phenyl]cyclohexyl]ethyl]benzene (PubChem CID 58699027) has the molecular formula C31H38O and a molecular weight of 426.64 g/mol. Its IUPAC name is 1-ethoxy-4-[2-[4-[4-[(2R)-2-phenylpropyl]phenyl]cyclohexyl]ethyl]benzene.
| Compound Name | 1-ethoxy-4-[2-[4-[4-[(2R)-2-phenylpropyl]phenyl]cyclohexyl]ethyl]benzene |
|---|---|
| PubChem CID | 58699027 |
| Molecular Formula | C31H38O |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | 1-ethoxy-4-[2-[4-[4-[(2R)-2-phenylpropyl]phenyl]cyclohexyl]ethyl]benzene |
| SMILES | CCOc1ccc(CCC2CCC(c3ccc(C[C@@H](C)c4ccccc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C31H38O/c1-3-32-31-21-15-26(16-22-31)10-9-25-11-17-29(18-12-25)30-19-13-27(14-20-30)23-24(2)28-7-5-4-6-8-28/h4-8,13-16,19-22,24-25,29H,3,9-12,17-18,23H2,1-2H3/t24-,25?,29?/m1/s1 |
| InChIKey | BEDNEOXPXDSDGN-XNORXSBBSA-N |
| XLogP | 8.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |