C31H44O — CID 58699202
1-ethoxy-4-[2-[4-[4-[(2S)-2-phenylpropyl]cyclohexyl]cyclohexyl]ethyl]benzene (PubChem CID 58699202) has the molecular formula C31H44O and a molecular weight of 432.69 g/mol. Its IUPAC name is 1-ethoxy-4-[2-[4-[4-[(2S)-2-phenylpropyl]cyclohexyl]cyclohexyl]ethyl]benzene.
| Compound Name | 1-ethoxy-4-[2-[4-[4-[(2S)-2-phenylpropyl]cyclohexyl]cyclohexyl]ethyl]benzene |
|---|---|
| PubChem CID | 58699202 |
| Molecular Formula | C31H44O |
| Molecular Weight | 432.69 g/mol |
| Exact Mass | 432.34 |
| IUPAC Name | 1-ethoxy-4-[2-[4-[4-[(2S)-2-phenylpropyl]cyclohexyl]cyclohexyl]ethyl]benzene |
| SMILES | CCOc1ccc(CCC2CCC(C3CCC(C[C@H](C)c4ccccc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C31H44O/c1-3-32-31-21-15-26(16-22-31)10-9-25-11-17-29(18-12-25)30-19-13-27(14-20-30)23-24(2)28-7-5-4-6-8-28/h4-8,15-16,21-22,24-25,27,29-30H,3,9-14,17-20,23H2,1-2H3/t24-,25?,27?,29?,30?/m0/s1 |
| InChIKey | OJUQYWSNTMFLRZ-GLQLURSFSA-N |
| XLogP | 8.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.69 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |