C29H40O — CID 58698888
1-ethoxy-4-[4-[4-[(2R)-2-phenylpropyl]cyclohexyl]cyclohexyl]benzene (PubChem CID 58698888) has the molecular formula C29H40O and a molecular weight of 404.64 g/mol. Its IUPAC name is 1-ethoxy-4-[4-[4-[(2R)-2-phenylpropyl]cyclohexyl]cyclohexyl]benzene.
| Compound Name | 1-ethoxy-4-[4-[4-[(2R)-2-phenylpropyl]cyclohexyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 58698888 |
| Molecular Formula | C29H40O |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.31 |
| IUPAC Name | 1-ethoxy-4-[4-[4-[(2R)-2-phenylpropyl]cyclohexyl]cyclohexyl]benzene |
| SMILES | CCOc1ccc(C2CCC(C3CCC(C[C@@H](C)c4ccccc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C29H40O/c1-3-30-29-19-17-28(18-20-29)27-15-13-26(14-16-27)25-11-9-23(10-12-25)21-22(2)24-7-5-4-6-8-24/h4-8,17-20,22-23,25-27H,3,9-16,21H2,1-2H3/t22-,23?,25?,26?,27?/m1/s1 |
| InChIKey | KYPBWNWPZTWYQD-GFJOJVLOSA-N |
| XLogP | 8.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |