C31H42O2 — CID 58698956
(4-propylcyclohexyl) 4-[4-[(2S)-2-phenylpropyl]cyclohexyl]benzoate (PubChem CID 58698956) has the molecular formula C31H42O2 and a molecular weight of 446.68 g/mol. Its IUPAC name is (4-propylcyclohexyl) 4-[4-[(2S)-2-phenylpropyl]cyclohexyl]benzoate.
| Compound Name | (4-propylcyclohexyl) 4-[4-[(2S)-2-phenylpropyl]cyclohexyl]benzoate |
|---|---|
| PubChem CID | 58698956 |
| Molecular Formula | C31H42O2 |
| Molecular Weight | 446.68 g/mol |
| Exact Mass | 446.32 |
| IUPAC Name | (4-propylcyclohexyl) 4-[4-[(2S)-2-phenylpropyl]cyclohexyl]benzoate |
| SMILES | CCCC1CCC(OC(=O)c2ccc(C3CCC(C[C@H](C)c4ccccc4)CC3)cc2)CC1 |
| InChI | InChI=1S/C31H42O2/c1-3-7-24-12-20-30(21-13-24)33-31(32)29-18-16-28(17-19-29)27-14-10-25(11-15-27)22-23(2)26-8-5-4-6-9-26/h4-6,8-9,16-19,23-25,27,30H,3,7,10-15,20-22H2,1-2H3/t23-,24?,25?,27?,30?/m0/s1 |
| InChIKey | VHZKNTGQYSVYSI-PGADRCIQSA-N |
| XLogP | 8.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.68 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |