C33H44O2 — CID 58699211
[4-[(E)-pent-3-enyl]cyclohexyl] 4-[4-[(2R)-2-phenylpropyl]cyclohexyl]benzoate (PubChem CID 58699211) has the molecular formula C33H44O2 and a molecular weight of 472.71 g/mol. Its IUPAC name is [4-[(E)-pent-3-enyl]cyclohexyl] 4-[4-[(2R)-2-phenylpropyl]cyclohexyl]benzoate.
| Compound Name | [4-[(E)-pent-3-enyl]cyclohexyl] 4-[4-[(2R)-2-phenylpropyl]cyclohexyl]benzoate |
|---|---|
| PubChem CID | 58699211 |
| Molecular Formula | C33H44O2 |
| Molecular Weight | 472.71 g/mol |
| Exact Mass | 472.33 |
| IUPAC Name | [4-[(E)-pent-3-enyl]cyclohexyl] 4-[4-[(2R)-2-phenylpropyl]cyclohexyl]benzoate |
| SMILES | C/C=C/CCC1CCC(OC(=O)c2ccc(C3CCC(C[C@@H](C)c4ccccc4)CC3)cc2)CC1 |
| InChI | InChI=1S/C33H44O2/c1-3-4-6-9-26-14-22-32(23-15-26)35-33(34)31-20-18-30(19-21-31)29-16-12-27(13-17-29)24-25(2)28-10-7-5-8-11-28/h3-5,7-8,10-11,18-21,25-27,29,32H,6,9,12-17,22-24H2,1-2H3/b4-3+/t25-,26?,27?,29?,32?/m1/s1 |
| InChIKey | XVLYMFALRWNYJP-CHQWORDNSA-N |
| XLogP | 9.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.71 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|