C32H38 — CID 58698248
1-[(E)-pent-3-enyl]-4-[4-[4-[(2S)-2-phenylpropyl]cyclohexyl]phenyl]benzene (PubChem CID 58698248) has the molecular formula C32H38 and a molecular weight of 422.66 g/mol. Its IUPAC name is 1-[(E)-pent-3-enyl]-4-[4-[4-[(2S)-2-phenylpropyl]cyclohexyl]phenyl]benzene.
| Compound Name | 1-[(E)-pent-3-enyl]-4-[4-[4-[(2S)-2-phenylpropyl]cyclohexyl]phenyl]benzene |
|---|---|
| PubChem CID | 58698248 |
| Molecular Formula | C32H38 |
| Molecular Weight | 422.66 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | 1-[(E)-pent-3-enyl]-4-[4-[4-[(2S)-2-phenylpropyl]cyclohexyl]phenyl]benzene |
| SMILES | C/C=C/CCc1ccc(-c2ccc(C3CCC(C[C@H](C)c4ccccc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C32H38/c1-3-4-6-9-26-12-16-29(17-13-26)31-20-22-32(23-21-31)30-18-14-27(15-19-30)24-25(2)28-10-7-5-8-11-28/h3-5,7-8,10-13,16-17,20-23,25,27,30H,6,9,14-15,18-19,24H2,1-2H3/b4-3+/t25-,27?,30?/m0/s1 |
| InChIKey | KKRIKXUIDXSJQF-GYKAWRSMSA-N |
| XLogP | 9.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.66 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|