C34H46F2 — CID 91318136
1,3-difluoro-2-pent-3-enyl-5-[4-[2-[4-[(2R)-2-phenylpropyl]cyclohexyl]ethyl]cyclohexyl]benzene (PubChem CID 91318136) has the molecular formula C34H46F2 and a molecular weight of 492.74 g/mol. Its IUPAC name is 1,3-difluoro-2-pent-3-enyl-5-[4-[2-[4-[(2R)-2-phenylpropyl]cyclohexyl]ethyl]cyclohexyl]benzene.
| Compound Name | 1,3-difluoro-2-pent-3-enyl-5-[4-[2-[4-[(2R)-2-phenylpropyl]cyclohexyl]ethyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 91318136 |
| Molecular Formula | C34H46F2 |
| Molecular Weight | 492.74 g/mol |
| Exact Mass | 492.36 |
| IUPAC Name | 1,3-difluoro-2-pent-3-enyl-5-[4-[2-[4-[(2R)-2-phenylpropyl]cyclohexyl]ethyl]cyclohexyl]benzene |
| SMILES | CC=CCCc1c(F)cc(C2CCC(CCC3CCC(C[C@@H](C)c4ccccc4)CC3)CC2)cc1F |
| InChI | InChI=1S/C34H46F2/c1-3-4-6-11-32-33(35)23-31(24-34(32)36)30-20-18-27(19-21-30)13-12-26-14-16-28(17-15-26)22-25(2)29-9-7-5-8-10-29/h3-5,7-10,23-28,30H,6,11-22H2,1-2H3/t25-,26?,27?,28?,30?/m1/s1 |
| InChIKey | YHONOQGDLGENTG-MJNJOSISSA-N |
| XLogP | 10.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.74 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|