C32H42F2 — CID 58698259
1,3-difluoro-5-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]-2-[(2S)-2-phenylpropyl]benzene (PubChem CID 58698259) has the molecular formula C32H42F2 and a molecular weight of 464.68 g/mol. Its IUPAC name is 1,3-difluoro-5-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]-2-[(2S)-2-phenylpropyl]benzene.
| Compound Name | 1,3-difluoro-5-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]-2-[(2S)-2-phenylpropyl]benzene |
|---|---|
| PubChem CID | 58698259 |
| Molecular Formula | C32H42F2 |
| Molecular Weight | 464.68 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | 1,3-difluoro-5-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]-2-[(2S)-2-phenylpropyl]benzene |
| SMILES | C/C=C/CCC1CCC(C2CCC(c3cc(F)c(C[C@H](C)c4ccccc4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C32H42F2/c1-3-4-6-9-24-12-14-26(15-13-24)27-16-18-28(19-17-27)29-21-31(33)30(32(34)22-29)20-23(2)25-10-7-5-8-11-25/h3-5,7-8,10-11,21-24,26-28H,6,9,12-20H2,1-2H3/b4-3+/t23-,24?,26?,27?,28?/m0/s1 |
| InChIKey | DZIIRZNBZJPKGP-HGRACMAQSA-N |
| XLogP | 9.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.68 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|