C32H34F4 — CID 58698391
2-[3,5-difluoro-4-[(E)-pent-3-enyl]phenyl]-1,3-difluoro-5-[4-[(2R)-2-phenylpropyl]cyclohexyl]benzene (PubChem CID 58698391) has the molecular formula C32H34F4 and a molecular weight of 494.62 g/mol. Its IUPAC name is 2-[3,5-difluoro-4-[(E)-pent-3-enyl]phenyl]-1,3-difluoro-5-[4-[(2R)-2-phenylpropyl]cyclohexyl]benzene.
| Compound Name | 2-[3,5-difluoro-4-[(E)-pent-3-enyl]phenyl]-1,3-difluoro-5-[4-[(2R)-2-phenylpropyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 58698391 |
| Molecular Formula | C32H34F4 |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | 2-[3,5-difluoro-4-[(E)-pent-3-enyl]phenyl]-1,3-difluoro-5-[4-[(2R)-2-phenylpropyl]cyclohexyl]benzene |
| SMILES | C/C=C/CCc1c(F)cc(-c2c(F)cc(C3CCC(C[C@@H](C)c4ccccc4)CC3)cc2F)cc1F |
| InChI | InChI=1S/C32H34F4/c1-3-4-6-11-27-28(33)19-26(20-29(27)34)32-30(35)17-25(18-31(32)36)24-14-12-22(13-15-24)16-21(2)23-9-7-5-8-10-23/h3-5,7-10,17-22,24H,6,11-16H2,1-2H3/b4-3+/t21-,22?,24?/m1/s1 |
| InChIKey | LUPBFCJBPRPTRO-XODOQUGCSA-N |
| XLogP | 9.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|