C34H40F2 — CID 58698580
1,3-difluoro-5-[4-[2-[4-[(E)-pent-3-enyl]phenyl]ethyl]cyclohexyl]-2-[(2S)-2-phenylpropyl]benzene (PubChem CID 58698580) has the molecular formula C34H40F2 and a molecular weight of 486.69 g/mol. Its IUPAC name is 1,3-difluoro-5-[4-[2-[4-[(E)-pent-3-enyl]phenyl]ethyl]cyclohexyl]-2-[(2S)-2-phenylpropyl]benzene.
| Compound Name | 1,3-difluoro-5-[4-[2-[4-[(E)-pent-3-enyl]phenyl]ethyl]cyclohexyl]-2-[(2S)-2-phenylpropyl]benzene |
|---|---|
| PubChem CID | 58698580 |
| Molecular Formula | C34H40F2 |
| Molecular Weight | 486.69 g/mol |
| Exact Mass | 486.31 |
| IUPAC Name | 1,3-difluoro-5-[4-[2-[4-[(E)-pent-3-enyl]phenyl]ethyl]cyclohexyl]-2-[(2S)-2-phenylpropyl]benzene |
| SMILES | C/C=C/CCc1ccc(CCC2CCC(c3cc(F)c(C[C@H](C)c4ccccc4)c(F)c3)CC2)cc1 |
| InChI | InChI=1S/C34H40F2/c1-3-4-6-9-26-12-14-27(15-13-26)16-17-28-18-20-30(21-19-28)31-23-33(35)32(34(36)24-31)22-25(2)29-10-7-5-8-11-29/h3-5,7-8,10-15,23-25,28,30H,6,9,16-22H2,1-2H3/b4-3+/t25-,28?,30?/m0/s1 |
| InChIKey | CMQHOSAIUXREKV-DROFKVAXSA-N |
| XLogP | 9.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.69 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|