C32H37F — CID 90730414
2-fluoro-1-pent-3-enyl-4-[4-[4-[(2R)-2-phenylpropyl]cyclohexyl]phenyl]benzene (PubChem CID 90730414) has the molecular formula C32H37F and a molecular weight of 440.65 g/mol. Its IUPAC name is 2-fluoro-1-pent-3-enyl-4-[4-[4-[(2R)-2-phenylpropyl]cyclohexyl]phenyl]benzene.
| Compound Name | 2-fluoro-1-pent-3-enyl-4-[4-[4-[(2R)-2-phenylpropyl]cyclohexyl]phenyl]benzene |
|---|---|
| PubChem CID | 90730414 |
| Molecular Formula | C32H37F |
| Molecular Weight | 440.65 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | 2-fluoro-1-pent-3-enyl-4-[4-[4-[(2R)-2-phenylpropyl]cyclohexyl]phenyl]benzene |
| SMILES | CC=CCCc1ccc(-c2ccc(C3CCC(C[C@@H](C)c4ccccc4)CC3)cc2)cc1F |
| InChI | InChI=1S/C32H37F/c1-3-4-6-11-30-20-21-31(23-32(30)33)29-18-16-28(17-19-29)27-14-12-25(13-15-27)22-24(2)26-9-7-5-8-10-26/h3-5,7-10,16-21,23-25,27H,6,11-15,22H2,1-2H3/t24-,25?,27?/m1/s1 |
| InChIKey | FBWXOMOWWQMDBV-VTRCLXOYSA-N |
| XLogP | 9.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.65 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|