C30H35F — CID 58699243
2-fluoro-4-[4-[4-[(2R)-2-phenylpropyl]cyclohexyl]phenyl]-1-propylbenzene (PubChem CID 58699243) has the molecular formula C30H35F and a molecular weight of 414.61 g/mol. Its IUPAC name is 2-fluoro-4-[4-[4-[(2R)-2-phenylpropyl]cyclohexyl]phenyl]-1-propylbenzene.
| Compound Name | 2-fluoro-4-[4-[4-[(2R)-2-phenylpropyl]cyclohexyl]phenyl]-1-propylbenzene |
|---|---|
| PubChem CID | 58699243 |
| Molecular Formula | C30H35F |
| Molecular Weight | 414.61 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | 2-fluoro-4-[4-[4-[(2R)-2-phenylpropyl]cyclohexyl]phenyl]-1-propylbenzene |
| SMILES | CCCc1ccc(-c2ccc(C3CCC(C[C@@H](C)c4ccccc4)CC3)cc2)cc1F |
| InChI | InChI=1S/C30H35F/c1-3-7-28-18-19-29(21-30(28)31)27-16-14-26(15-17-27)25-12-10-23(11-13-25)20-22(2)24-8-5-4-6-9-24/h4-6,8-9,14-19,21-23,25H,3,7,10-13,20H2,1-2H3/t22-,23?,25?/m1/s1 |
| InChIKey | QUHAAJDIOPIXOQ-BJYSPHJKSA-N |
| XLogP | 8.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.61 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |