C31H35FO2 — CID 58698191
(3-fluoro-4-propylphenyl) 4-[4-[(2R)-2-phenylpropyl]cyclohexyl]benzoate (PubChem CID 58698191) has the molecular formula C31H35FO2 and a molecular weight of 458.62 g/mol. Its IUPAC name is (3-fluoro-4-propylphenyl) 4-[4-[(2R)-2-phenylpropyl]cyclohexyl]benzoate.
| Compound Name | (3-fluoro-4-propylphenyl) 4-[4-[(2R)-2-phenylpropyl]cyclohexyl]benzoate |
|---|---|
| PubChem CID | 58698191 |
| Molecular Formula | C31H35FO2 |
| Molecular Weight | 458.62 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | (3-fluoro-4-propylphenyl) 4-[4-[(2R)-2-phenylpropyl]cyclohexyl]benzoate |
| SMILES | CCCc1ccc(OC(=O)c2ccc(C3CCC(C[C@@H](C)c4ccccc4)CC3)cc2)cc1F |
| InChI | InChI=1S/C31H35FO2/c1-3-7-27-18-19-29(21-30(27)32)34-31(33)28-16-14-26(15-17-28)25-12-10-23(11-13-25)20-22(2)24-8-5-4-6-9-24/h4-6,8-9,14-19,21-23,25H,3,7,10-13,20H2,1-2H3/t22-,23?,25?/m1/s1 |
| InChIKey | NSHCRJNNBRSFKL-BJYSPHJKSA-N |
| XLogP | 8.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.62 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|