C29H25F4NO2 — CID 58698083
(4-cyano-3,5-difluorophenyl) 2,6-difluoro-4-[4-[(2S)-2-phenylpropyl]cyclohexyl]benzoate (PubChem CID 58698083) has the molecular formula C29H25F4NO2 and a molecular weight of 495.52 g/mol. Its IUPAC name is (4-cyano-3,5-difluorophenyl) 2,6-difluoro-4-[4-[(2S)-2-phenylpropyl]cyclohexyl]benzoate.
| Compound Name | (4-cyano-3,5-difluorophenyl) 2,6-difluoro-4-[4-[(2S)-2-phenylpropyl]cyclohexyl]benzoate |
|---|---|
| PubChem CID | 58698083 |
| Molecular Formula | C29H25F4NO2 |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | (4-cyano-3,5-difluorophenyl) 2,6-difluoro-4-[4-[(2S)-2-phenylpropyl]cyclohexyl]benzoate |
| SMILES | C[C@@H](CC1CCC(c2cc(F)c(C(=O)Oc3cc(F)c(C#N)c(F)c3)c(F)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C29H25F4NO2/c1-17(19-5-3-2-4-6-19)11-18-7-9-20(10-8-18)21-12-26(32)28(27(33)13-21)29(35)36-22-14-24(30)23(16-34)25(31)15-22/h2-6,12-15,17-18,20H,7-11H2,1H3/t17-,18?,20?/m0/s1 |
| InChIKey | FOSLSYCRQCRJAI-ZJRDLVKKSA-N |
| XLogP | 7.80 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|