C29H29NO2 — CID 58699437
(4-cyanophenyl) 4-[4-[(2S)-2-phenylpropyl]cyclohexyl]benzoate (PubChem CID 58699437) has the molecular formula C29H29NO2 and a molecular weight of 423.56 g/mol. Its IUPAC name is (4-cyanophenyl) 4-[4-[(2S)-2-phenylpropyl]cyclohexyl]benzoate.
| Compound Name | (4-cyanophenyl) 4-[4-[(2S)-2-phenylpropyl]cyclohexyl]benzoate |
|---|---|
| PubChem CID | 58699437 |
| Molecular Formula | C29H29NO2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | (4-cyanophenyl) 4-[4-[(2S)-2-phenylpropyl]cyclohexyl]benzoate |
| SMILES | C[C@@H](CC1CCC(c2ccc(C(=O)Oc3ccc(C#N)cc3)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C29H29NO2/c1-21(24-5-3-2-4-6-24)19-22-7-11-25(12-8-22)26-13-15-27(16-14-26)29(31)32-28-17-9-23(20-30)10-18-28/h2-6,9-10,13-18,21-22,25H,7-8,11-12,19H2,1H3/t21-,22?,25?/m0/s1 |
| InChIKey | YUICYMOQRCEZOZ-LBXYRFPKSA-N |
| XLogP | 7.25 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|