C28H27F3O2 — CID 21052884
(3,4,5-trifluorophenyl) 4-[4-(2-phenylpropyl)cyclohexyl]benzoate (PubChem CID 21052884) has the molecular formula C28H27F3O2 and a molecular weight of 452.52 g/mol. Its IUPAC name is (3,4,5-trifluorophenyl) 4-[4-(2-phenylpropyl)cyclohexyl]benzoate.
| Compound Name | (3,4,5-trifluorophenyl) 4-[4-(2-phenylpropyl)cyclohexyl]benzoate |
|---|---|
| PubChem CID | 21052884 |
| Molecular Formula | C28H27F3O2 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | (3,4,5-trifluorophenyl) 4-[4-(2-phenylpropyl)cyclohexyl]benzoate |
| SMILES | CC(CC1CCC(c2ccc(C(=O)Oc3cc(F)c(F)c(F)c3)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C28H27F3O2/c1-18(20-5-3-2-4-6-20)15-19-7-9-21(10-8-19)22-11-13-23(14-12-22)28(32)33-24-16-25(29)27(31)26(30)17-24/h2-6,11-14,16-19,21H,7-10,15H2,1H3 |
| InChIKey | SFEXXZFPLBJTJC-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|