C30H30F4O3 — CID 58698469
(4-ethoxy-3,5-difluorophenyl) 2,6-difluoro-4-[4-[(2S)-2-phenylpropyl]cyclohexyl]benzoate (PubChem CID 58698469) has the molecular formula C30H30F4O3 and a molecular weight of 514.56 g/mol. Its IUPAC name is (4-ethoxy-3,5-difluorophenyl) 2,6-difluoro-4-[4-[(2S)-2-phenylpropyl]cyclohexyl]benzoate.
| Compound Name | (4-ethoxy-3,5-difluorophenyl) 2,6-difluoro-4-[4-[(2S)-2-phenylpropyl]cyclohexyl]benzoate |
|---|---|
| PubChem CID | 58698469 |
| Molecular Formula | C30H30F4O3 |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | (4-ethoxy-3,5-difluorophenyl) 2,6-difluoro-4-[4-[(2S)-2-phenylpropyl]cyclohexyl]benzoate |
| SMILES | CCOc1c(F)cc(OC(=O)c2c(F)cc(C3CCC(C[C@H](C)c4ccccc4)CC3)cc2F)cc1F |
| InChI | InChI=1S/C30H30F4O3/c1-3-36-29-26(33)16-23(17-27(29)34)37-30(35)28-24(31)14-22(15-25(28)32)21-11-9-19(10-12-21)13-18(2)20-7-5-4-6-8-20/h4-8,14-19,21H,3,9-13H2,1-2H3/t18-,19?,21?/m0/s1 |
| InChIKey | FTWGTIHPVVDTOZ-JSOIOWGOSA-N |
| XLogP | 8.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|