C29H39FO — CID 71102900
2-fluoro-4-[4-[2-[4-[(2S)-2-phenylpropyl]cyclohexyl]ethyl]cyclohexyl]phenol (PubChem CID 71102900) has the molecular formula C29H39FO and a molecular weight of 422.63 g/mol. Its IUPAC name is 2-fluoro-4-[4-[2-[4-[(2S)-2-phenylpropyl]cyclohexyl]ethyl]cyclohexyl]phenol.
| Compound Name | 2-fluoro-4-[4-[2-[4-[(2S)-2-phenylpropyl]cyclohexyl]ethyl]cyclohexyl]phenol |
|---|---|
| PubChem CID | 71102900 |
| Molecular Formula | C29H39FO |
| Molecular Weight | 422.63 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | 2-fluoro-4-[4-[2-[4-[(2S)-2-phenylpropyl]cyclohexyl]ethyl]cyclohexyl]phenol |
| SMILES | C[C@@H](CC1CCC(CCC2CCC(c3ccc(O)c(F)c3)CC2)CC1)c1ccccc1 |
| InChI | InChI=1S/C29H39FO/c1-21(25-5-3-2-4-6-25)19-24-11-9-22(10-12-24)7-8-23-13-15-26(16-14-23)27-17-18-29(31)28(30)20-27/h2-6,17-18,20-24,26,31H,7-16,19H2,1H3/t21-,22?,23?,24?,26?/m0/s1 |
| InChIKey | DNGAZEDLTDNIEQ-WSHMSRCKSA-N |
| XLogP | 8.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.63 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |