C27H35Cl — CID 58698353
1-chloro-4-[4-[4-[(2R)-2-phenylpropyl]cyclohexyl]cyclohexyl]benzene (PubChem CID 58698353) has the molecular formula C27H35Cl and a molecular weight of 395.03 g/mol. Its IUPAC name is 1-chloro-4-[4-[4-[(2R)-2-phenylpropyl]cyclohexyl]cyclohexyl]benzene.
| Compound Name | 1-chloro-4-[4-[4-[(2R)-2-phenylpropyl]cyclohexyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 58698353 |
| Molecular Formula | C27H35Cl |
| Molecular Weight | 395.03 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 1-chloro-4-[4-[4-[(2R)-2-phenylpropyl]cyclohexyl]cyclohexyl]benzene |
| SMILES | C[C@H](CC1CCC(C2CCC(c3ccc(Cl)cc3)CC2)CC1)c1ccccc1 |
| InChI | InChI=1S/C27H35Cl/c1-20(22-5-3-2-4-6-22)19-21-7-9-23(10-8-21)24-11-13-25(14-12-24)26-15-17-27(28)18-16-26/h2-6,15-18,20-21,23-25H,7-14,19H2,1H3/t20-,21?,23?,24?,25?/m1/s1 |
| InChIKey | KDIMFWOCURLEEX-MROVBQIPSA-N |
| XLogP | 8.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.03 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |