C29H33Cl — CID 58699463
1-chloro-4-[4-[2-[4-[(2S)-2-phenylpropyl]cyclohexyl]ethyl]phenyl]benzene (PubChem CID 58699463) has the molecular formula C29H33Cl and a molecular weight of 417.04 g/mol. Its IUPAC name is 1-chloro-4-[4-[2-[4-[(2S)-2-phenylpropyl]cyclohexyl]ethyl]phenyl]benzene.
| Compound Name | 1-chloro-4-[4-[2-[4-[(2S)-2-phenylpropyl]cyclohexyl]ethyl]phenyl]benzene |
|---|---|
| PubChem CID | 58699463 |
| Molecular Formula | C29H33Cl |
| Molecular Weight | 417.04 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 1-chloro-4-[4-[2-[4-[(2S)-2-phenylpropyl]cyclohexyl]ethyl]phenyl]benzene |
| SMILES | C[C@@H](CC1CCC(CCc2ccc(-c3ccc(Cl)cc3)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C29H33Cl/c1-22(26-5-3-2-4-6-26)21-25-11-9-23(10-12-25)7-8-24-13-15-27(16-14-24)28-17-19-29(30)20-18-28/h2-6,13-20,22-23,25H,7-12,21H2,1H3/t22-,23?,25?/m0/s1 |
| InChIKey | CJRLFEYQIJGWLE-ICXLUZGWSA-N |
| XLogP | 8.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.04 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |