C31H35F — CID 58698899
1-fluoro-4-[2-[4-[2-[4-[(2S)-2-phenylpropyl]cyclohexyl]ethyl]phenyl]ethenyl]benzene (PubChem CID 58698899) has the molecular formula C31H35F and a molecular weight of 426.62 g/mol. Its IUPAC name is 1-fluoro-4-[2-[4-[2-[4-[(2S)-2-phenylpropyl]cyclohexyl]ethyl]phenyl]ethenyl]benzene.
| Compound Name | 1-fluoro-4-[2-[4-[2-[4-[(2S)-2-phenylpropyl]cyclohexyl]ethyl]phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 58698899 |
| Molecular Formula | C31H35F |
| Molecular Weight | 426.62 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | 1-fluoro-4-[2-[4-[2-[4-[(2S)-2-phenylpropyl]cyclohexyl]ethyl]phenyl]ethenyl]benzene |
| SMILES | C[C@@H](CC1CCC(CCc2ccc(C=Cc3ccc(F)cc3)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C31H35F/c1-24(30-5-3-2-4-6-30)23-29-17-15-27(16-18-29)12-11-25-7-9-26(10-8-25)13-14-28-19-21-31(32)22-20-28/h2-10,13-14,19-22,24,27,29H,11-12,15-18,23H2,1H3/t24-,27?,29?/m0/s1 |
| InChIKey | SRIVFFJZPUETAE-LVLBOJHCSA-N |
| XLogP | 8.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.62 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|