C22H28 — CID 163627062
1-methyl-4-[4-[(2R)-2-phenylpropyl]cyclohexyl]benzene (PubChem CID 163627062) has the molecular formula C22H28 and a molecular weight of 292.47 g/mol. Its IUPAC name is 1-methyl-4-[4-[(2R)-2-phenylpropyl]cyclohexyl]benzene.
| Compound Name | 1-methyl-4-[4-[(2R)-2-phenylpropyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 163627062 |
| Molecular Formula | C22H28 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 1-methyl-4-[4-[(2R)-2-phenylpropyl]cyclohexyl]benzene |
| SMILES | Cc1ccc(C2CCC(C[C@@H](C)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H28/c1-17-8-12-21(13-9-17)22-14-10-19(11-15-22)16-18(2)20-6-4-3-5-7-20/h3-9,12-13,18-19,22H,10-11,14-16H2,1-2H3/t18-,19?,22?/m1/s1 |
| InChIKey | HSXLQGKWIQNHPR-FLPIEVNYSA-N |
| XLogP | 6.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |