C24H37Cl — CID 139753503
1-chloro-4-[(2R)-1-[4-(4-propylcyclohexyl)cyclohexyl]propan-2-yl]benzene (PubChem CID 139753503) has the molecular formula C24H37Cl and a molecular weight of 361.01 g/mol. Its IUPAC name is 1-chloro-4-[(2R)-1-[4-(4-propylcyclohexyl)cyclohexyl]propan-2-yl]benzene.
| Compound Name | 1-chloro-4-[(2R)-1-[4-(4-propylcyclohexyl)cyclohexyl]propan-2-yl]benzene |
|---|---|
| PubChem CID | 139753503 |
| Molecular Formula | C24H37Cl |
| Molecular Weight | 361.01 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | 1-chloro-4-[(2R)-1-[4-(4-propylcyclohexyl)cyclohexyl]propan-2-yl]benzene |
| SMILES | CCCC1CCC(C2CCC(C[C@@H](C)c3ccc(Cl)cc3)CC2)CC1 |
| InChI | InChI=1S/C24H37Cl/c1-3-4-19-5-9-22(10-6-19)23-11-7-20(8-12-23)17-18(2)21-13-15-24(25)16-14-21/h13-16,18-20,22-23H,3-12,17H2,1-2H3/t18-,19?,20?,22?,23?/m1/s1 |
| InChIKey | NFMVBEVVJACJJD-BSODEFTDSA-N |
| XLogP | 8.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.01 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |