C28H44 — CID 139753529
1-[(2R)-1-[4-(4-but-3-enylcyclohexyl)cyclohexyl]propan-2-yl]-4-propylbenzene (PubChem CID 139753529) has the molecular formula C28H44 and a molecular weight of 380.66 g/mol. Its IUPAC name is 1-[(2R)-1-[4-(4-but-3-enylcyclohexyl)cyclohexyl]propan-2-yl]-4-propylbenzene.
| Compound Name | 1-[(2R)-1-[4-(4-but-3-enylcyclohexyl)cyclohexyl]propan-2-yl]-4-propylbenzene |
|---|---|
| PubChem CID | 139753529 |
| Molecular Formula | C28H44 |
| Molecular Weight | 380.66 g/mol |
| Exact Mass | 380.34 |
| IUPAC Name | 1-[(2R)-1-[4-(4-but-3-enylcyclohexyl)cyclohexyl]propan-2-yl]-4-propylbenzene |
| SMILES | C=CCCC1CCC(C2CCC(C[C@@H](C)c3ccc(CCC)cc3)CC2)CC1 |
| InChI | InChI=1S/C28H44/c1-4-6-8-24-11-17-27(18-12-24)28-19-13-25(14-20-28)21-22(3)26-15-9-23(7-5-2)10-16-26/h4,9-10,15-16,22,24-25,27-28H,1,5-8,11-14,17-21H2,2-3H3/t22-,24?,25?,27?,28?/m1/s1 |
| InChIKey | BLIFOEBIXNZVSF-FWIUKZLTSA-N |
| XLogP | 8.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.66 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|