C29H42 — CID 139753533
1-propyl-4-[2-[4-[(2R)-1-(4-propylcyclohexyl)propan-2-yl]phenyl]ethyl]benzene (PubChem CID 139753533) has the molecular formula C29H42 and a molecular weight of 390.66 g/mol. Its IUPAC name is 1-propyl-4-[2-[4-[(2R)-1-(4-propylcyclohexyl)propan-2-yl]phenyl]ethyl]benzene.
| Compound Name | 1-propyl-4-[2-[4-[(2R)-1-(4-propylcyclohexyl)propan-2-yl]phenyl]ethyl]benzene |
|---|---|
| PubChem CID | 139753533 |
| Molecular Formula | C29H42 |
| Molecular Weight | 390.66 g/mol |
| Exact Mass | 390.33 |
| IUPAC Name | 1-propyl-4-[2-[4-[(2R)-1-(4-propylcyclohexyl)propan-2-yl]phenyl]ethyl]benzene |
| SMILES | CCCc1ccc(CCc2ccc([C@H](C)CC3CCC(CCC)CC3)cc2)cc1 |
| InChI | InChI=1S/C29H42/c1-4-6-24-8-10-26(11-9-24)12-13-27-18-20-29(21-19-27)23(3)22-28-16-14-25(7-5-2)15-17-28/h8-11,18-21,23,25,28H,4-7,12-17,22H2,1-3H3/t23-,25?,28?/m1/s1 |
| InChIKey | IACJILNUZALHCM-PWKHNDMNSA-N |
| XLogP | 8.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.66 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |