C19H30O2 — CID 22089378
1-[hydroperoxy-(4-propylcyclohexyl)methyl]-4-propylbenzene (PubChem CID 22089378) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 1-[hydroperoxy-(4-propylcyclohexyl)methyl]-4-propylbenzene.
| Compound Name | 1-[hydroperoxy-(4-propylcyclohexyl)methyl]-4-propylbenzene |
|---|---|
| PubChem CID | 22089378 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 1-[hydroperoxy-(4-propylcyclohexyl)methyl]-4-propylbenzene |
| SMILES | CCCc1ccc(C(OO)C2CCC(CCC)CC2)cc1 |
| InChI | InChI=1S/C19H30O2/c1-3-5-15-7-11-17(12-8-15)19(21-20)18-13-9-16(6-4-2)10-14-18/h7-8,11-12,16,18-20H,3-6,9-10,13-14H2,1-2H3 |
| InChIKey | AXMPLOVCMGZHAU-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|