C21H34O2 — CID 22089375
1-[hydroperoxy-(4-pentylcyclohexyl)methyl]-4-propylbenzene (PubChem CID 22089375) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is 1-[hydroperoxy-(4-pentylcyclohexyl)methyl]-4-propylbenzene.
| Compound Name | 1-[hydroperoxy-(4-pentylcyclohexyl)methyl]-4-propylbenzene |
|---|---|
| PubChem CID | 22089375 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | 1-[hydroperoxy-(4-pentylcyclohexyl)methyl]-4-propylbenzene |
| SMILES | CCCCCC1CCC(C(OO)c2ccc(CCC)cc2)CC1 |
| InChI | InChI=1S/C21H34O2/c1-3-5-6-8-18-11-15-20(16-12-18)21(23-22)19-13-9-17(7-4-2)10-14-19/h9-10,13-14,18,20-22H,3-8,11-12,15-16H2,1-2H3 |
| InChIKey | DXOCVPWDSJWOBX-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|