C23H34 — CID 20809752
(2R,4aR,8aR)-2-but-3-enyl-6-(4-propylphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20809752) has the molecular formula C23H34 and a molecular weight of 310.53 g/mol. Its IUPAC name is (2R,4aR,8aR)-2-but-3-enyl-6-(4-propylphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (2R,4aR,8aR)-2-but-3-enyl-6-(4-propylphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20809752 |
| Molecular Formula | C23H34 |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.27 |
| IUPAC Name | (2R,4aR,8aR)-2-but-3-enyl-6-(4-propylphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C=CCC[C@@H]1CC[C@@H]2CC(c3ccc(CCC)cc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C23H34/c1-3-5-7-19-10-13-23-17-22(15-14-21(23)16-19)20-11-8-18(6-4-2)9-12-20/h3,8-9,11-12,19,21-23H,1,4-7,10,13-17H2,2H3/t19-,21-,22?,23-/m1/s1 |
| InChIKey | CABUFMBXVUYSIA-AGXQJBSZSA-N |
| XLogP | 6.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|