C33H46 — CID 20809434
(2R,4aR,8aR)-2-[4-(4-but-3-enylphenyl)phenyl]-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20809434) has the molecular formula C33H46 and a molecular weight of 442.73 g/mol. Its IUPAC name is (2R,4aR,8aR)-2-[4-(4-but-3-enylphenyl)phenyl]-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (2R,4aR,8aR)-2-[4-(4-but-3-enylphenyl)phenyl]-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20809434 |
| Molecular Formula | C33H46 |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 442.36 |
| IUPAC Name | (2R,4aR,8aR)-2-[4-(4-but-3-enylphenyl)phenyl]-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C=CCCc1ccc(-c2ccc([C@@H]3CC[C@@H]4CC(CCCCCCC)CC[C@@H]4C3)cc2)cc1 |
| InChI | InChI=1S/C33H46/c1-3-5-7-8-9-11-27-14-17-33-25-32(23-22-31(33)24-27)30-20-18-29(19-21-30)28-15-12-26(13-16-28)10-6-4-2/h4,12-13,15-16,18-21,27,31-33H,2-3,5-11,14,17,22-25H2,1H3/t27?,31-,32-,33-/m1/s1 |
| InChIKey | QJROEDAQWZIIST-QLHRNDQZSA-N |
| XLogP | 10.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|