C31H44 — CID 20807923
2-[(2R,4aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-but-3-enylnaphthalene (PubChem CID 20807923) has the molecular formula C31H44 and a molecular weight of 416.69 g/mol. Its IUPAC name is 2-[(2R,4aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-but-3-enylnaphthalene.
| Compound Name | 2-[(2R,4aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-but-3-enylnaphthalene |
|---|---|
| PubChem CID | 20807923 |
| Molecular Formula | C31H44 |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 416.34 |
| IUPAC Name | 2-[(2R,4aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-but-3-enylnaphthalene |
| SMILES | C=CCCc1ccc2cc([C@@H]3CC[C@@H]4CC(CCCCCCC)CCC4C3)ccc2c1 |
| InChI | InChI=1S/C31H44/c1-3-5-7-8-9-11-25-13-15-29-23-31(19-17-27(29)21-25)30-18-16-26-20-24(10-6-4-2)12-14-28(26)22-30/h4,12,14,16,18,20,22,25,27,29,31H,2-3,5-11,13,15,17,19,21,23H2,1H3/t25?,27-,29?,31-/m1/s1 |
| InChIKey | QECWWOFQHQQSSI-BUEGNPBQSA-N |
| XLogP | 9.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|