C31H43F — CID 20807856
3-[(2R,4aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-7-but-3-enyl-1-fluoronaphthalene (PubChem CID 20807856) has the molecular formula C31H43F and a molecular weight of 434.68 g/mol. Its IUPAC name is 3-[(2R,4aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-7-but-3-enyl-1-fluoronaphthalene.
| Compound Name | 3-[(2R,4aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-7-but-3-enyl-1-fluoronaphthalene |
|---|---|
| PubChem CID | 20807856 |
| Molecular Formula | C31H43F |
| Molecular Weight | 434.68 g/mol |
| Exact Mass | 434.33 |
| IUPAC Name | 3-[(2R,4aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-7-but-3-enyl-1-fluoronaphthalene |
| SMILES | C=CCCc1ccc2cc([C@@H]3CC[C@@H]4CC(CCCCCCC)CCC4C3)cc(F)c2c1 |
| InChI | InChI=1S/C31H43F/c1-3-5-7-8-9-11-23-12-14-26-20-27(17-16-25(26)18-23)29-21-28-15-13-24(10-6-4-2)19-30(28)31(32)22-29/h4,13,15,19,21-23,25-27H,2-3,5-12,14,16-18,20H2,1H3/t23?,25-,26?,27-/m1/s1 |
| InChIKey | XHVZLHUXEXWOMU-UDVZQLPGSA-N |
| XLogP | 9.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.68 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|