C33H44F2 — CID 20808948
(2R,4aR,8aR)-2-[4-(4-but-3-enylphenyl)-3,5-difluorophenyl]-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20808948) has the molecular formula C33H44F2 and a molecular weight of 478.71 g/mol. Its IUPAC name is (2R,4aR,8aR)-2-[4-(4-but-3-enylphenyl)-3,5-difluorophenyl]-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (2R,4aR,8aR)-2-[4-(4-but-3-enylphenyl)-3,5-difluorophenyl]-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20808948 |
| Molecular Formula | C33H44F2 |
| Molecular Weight | 478.71 g/mol |
| Exact Mass | 478.34 |
| IUPAC Name | (2R,4aR,8aR)-2-[4-(4-but-3-enylphenyl)-3,5-difluorophenyl]-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C=CCCc1ccc(-c2c(F)cc([C@@H]3CC[C@@H]4CC(CCCCCCC)CC[C@@H]4C3)cc2F)cc1 |
| InChI | InChI=1S/C33H44F2/c1-3-5-7-8-9-11-25-14-17-28-21-29(19-18-27(28)20-25)30-22-31(34)33(32(35)23-30)26-15-12-24(13-16-26)10-6-4-2/h4,12-13,15-16,22-23,25,27-29H,2-3,5-11,14,17-21H2,1H3/t25?,27-,28-,29-/m1/s1 |
| InChIKey | CMGMQNGSKFOPKN-VZXWBTEVSA-N |
| XLogP | 10.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.71 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|